C25H28N2O5S3 — CID 142671027
tert-butyl N-[4-[3-[2-(hydroxymethyl)-6-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophen-2-yl]-N-methanimidoylcarbamate (PubChem CID 142671027) has the molecular formula C25H28N2O5S3 and a molecular weight of 532.71 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[2-(hydroxymethyl)-6-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophen-2-yl]-N-methanimidoylcarbamate.
| Compound Name | tert-butyl N-[4-[3-[2-(hydroxymethyl)-6-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophen-2-yl]-N-methanimidoylcarbamate |
|---|---|
| PubChem CID | 142671027 |
| Molecular Formula | C25H28N2O5S3 |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | tert-butyl N-[4-[3-[2-(hydroxymethyl)-6-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophen-2-yl]-N-methanimidoylcarbamate |
| SMILES | [H]/N=C/N(C(=O)OC(C)(C)C)c1cc(S(=O)(=O)c2cccc(-c3c(C)cccc3CO)c2)c(SC)s1 |
| InChI | InChI=1S/C25H28N2O5S3/c1-16-8-6-10-18(14-28)22(16)17-9-7-11-19(12-17)35(30,31)20-13-21(34-23(20)33-5)27(15-26)24(29)32-25(2,3)4/h6-13,15,26,28H,14H2,1-5H3/b26-15+ |
| InChIKey | GIOUCNMIWLOWEZ-CVKSISIWSA-N |
| XLogP | 6.12 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|