C30H39N2O8PS3 — CID 87900315
tert-butyl N-[[4-[3-[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophen-2-yl]methylideneamino]carbamate (PubChem CID 87900315) has the molecular formula C30H39N2O8PS3 and a molecular weight of 682.82 g/mol. Its IUPAC name is tert-butyl N-[[4-[3-[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophen-2-yl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[[4-[3-[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophen-2-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 87900315 |
| Molecular Formula | C30H39N2O8PS3 |
| Molecular Weight | 682.82 g/mol |
| Exact Mass | 682.16 |
| IUPAC Name | tert-butyl N-[[4-[3-[4-(diethoxyphosphorylmethoxy)-2,6-dimethylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophen-2-yl]methylideneamino]carbamate |
| SMILES | CCOP(=O)(COc1cc(C)c(-c2cccc(S(=O)(=O)c3cc(C=NNC(=O)OC(C)(C)C)sc3SC)c2)c(C)c1)OCC |
| InChI | InChI=1S/C30H39N2O8PS3/c1-9-38-41(34,39-10-2)19-37-23-14-20(3)27(21(4)15-23)22-12-11-13-25(16-22)44(35,36)26-17-24(43-28(26)42-8)18-31-32-29(33)40-30(5,6)7/h11-18H,9-10,19H2,1-8H3,(H,32,33) |
| InChIKey | DYFVJRLOTOWKHB-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.82 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|