C14H16N2O2S — CID 16731403
tert-butyl N-[(E)-1-benzothiophen-2-ylmethylideneamino]carbamate (PubChem CID 16731403) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is tert-butyl N-[(E)-1-benzothiophen-2-ylmethylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-1-benzothiophen-2-ylmethylideneamino]carbamate |
|---|---|
| PubChem CID | 16731403 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | tert-butyl N-[(E)-1-benzothiophen-2-ylmethylideneamino]carbamate |
| SMILES | CC(C)(C)OC(=O)N/N=C/c1cc2ccccc2s1 |
| InChI | InChI=1S/C14H16N2O2S/c1-14(2,3)18-13(17)16-15-9-11-8-10-6-4-5-7-12(10)19-11/h4-9H,1-3H3,(H,16,17)/b15-9+ |
| InChIKey | JQXFUJBHODYWAW-OQLLNIDSSA-N |
| XLogP | 3.76 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|