C23H23ClN2O5S — CID 97305505
methyl (2R)-2-(4-chlorophenyl)-2-[[2-[(Z)-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]-1-benzothiophen-6-yl]oxy]acetate (PubChem CID 97305505) has the molecular formula C23H23ClN2O5S and a molecular weight of 474.97 g/mol. Its IUPAC name is methyl (2R)-2-(4-chlorophenyl)-2-[[2-[(Z)-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]-1-benzothiophen-6-yl]oxy]acetate.
| Compound Name | methyl (2R)-2-(4-chlorophenyl)-2-[[2-[(Z)-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]-1-benzothiophen-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 97305505 |
| Molecular Formula | C23H23ClN2O5S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | methyl (2R)-2-(4-chlorophenyl)-2-[[2-[(Z)-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]-1-benzothiophen-6-yl]oxy]acetate |
| SMILES | COC(=O)[C@H](Oc1ccc2cc(/C=N\NC(=O)OC(C)(C)C)sc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN2O5S/c1-23(2,3)31-22(28)26-25-13-18-11-15-7-10-17(12-19(15)32-18)30-20(21(27)29-4)14-5-8-16(24)9-6-14/h5-13,20H,1-4H3,(H,26,28)/b25-13-/t20-/m1/s1 |
| InChIKey | LSKMKBUMZHWZKG-KXQYWQJRSA-N |
| XLogP | 5.71 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|