C14H16N2O3S — CID 73014117
tert-butyl N-[(6-hydroxy-1-benzothiophen-2-yl)iminomethyl]carbamate (PubChem CID 73014117) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is tert-butyl N-[(6-hydroxy-1-benzothiophen-2-yl)iminomethyl]carbamate.
| Compound Name | tert-butyl N-[(6-hydroxy-1-benzothiophen-2-yl)iminomethyl]carbamate |
|---|---|
| PubChem CID | 73014117 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | tert-butyl N-[(6-hydroxy-1-benzothiophen-2-yl)iminomethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC=Nc1cc2ccc(O)cc2s1 |
| InChI | InChI=1S/C14H16N2O3S/c1-14(2,3)19-13(18)16-8-15-12-6-9-4-5-10(17)7-11(9)20-12/h4-8,17H,1-3H3,(H,15,16,18) |
| InChIKey | PTPWXXJLSZPNMG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|