C30H32F6N6O9S3 — CID 10056294
5-[[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-5-(diaminomethylideneamino)-3-methylbenzoyl]amino]pentanoic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 10056294) has the molecular formula C30H32F6N6O9S3 and a molecular weight of 830.81 g/mol. Its IUPAC name is 5-[[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-5-(diaminomethylideneamino)-3-methylbenzoyl]amino]pentanoic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 5-[[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-5-(diaminomethylideneamino)-3-methylbenzoyl]amino]pentanoic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 10056294 |
| Molecular Formula | C30H32F6N6O9S3 |
| Molecular Weight | 830.81 g/mol |
| Exact Mass | 830.13 |
| IUPAC Name | 5-[[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-5-(diaminomethylideneamino)-3-methylbenzoyl]amino]pentanoic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1cc(S(=O)(=O)c2cccc(-c3c(C)cc(N=C(N)N)cc3C(=O)NCCCCC(=O)O)c2)c(SC)s1 |
| InChI | InChI=1S/C26H30N6O5S3.2C2HF3O2/c1-14-10-16(32-26(29)30)12-18(24(35)31-9-4-3-8-21(33)34)22(14)15-6-5-7-17(11-15)40(36,37)20-13-19(23(27)28)39-25(20)38-2;2*3-2(4,5)1(6)7/h5-7,10-13H,3-4,8-9H2,1-2H3,(H3,27,28)(H,31,35)(H,33,34)(H4,29,30,32);2*(H,6,7) |
| InChIKey | UCLYQXDRJPJQHQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 289.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.81 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|