C26H31F2N3O3 — CID 176963513
4-[(4-ethoxy-2,3-difluorophenyl)methyl-[(3R)-3-ethoxy-3-[4-(methylamino)but-2-ynoxy]propyl]amino]benzonitrile (PubChem CID 176963513) has the molecular formula C26H31F2N3O3 and a molecular weight of 471.55 g/mol. Its IUPAC name is 4-[(4-ethoxy-2,3-difluorophenyl)methyl-[(3R)-3-ethoxy-3-[4-(methylamino)but-2-ynoxy]propyl]amino]benzonitrile.
| Compound Name | 4-[(4-ethoxy-2,3-difluorophenyl)methyl-[(3R)-3-ethoxy-3-[4-(methylamino)but-2-ynoxy]propyl]amino]benzonitrile |
|---|---|
| PubChem CID | 176963513 |
| Molecular Formula | C26H31F2N3O3 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 4-[(4-ethoxy-2,3-difluorophenyl)methyl-[(3R)-3-ethoxy-3-[4-(methylamino)but-2-ynoxy]propyl]amino]benzonitrile |
| SMILES | CCOc1ccc(CN(CC[C@H](OCC)OCC#CCNC)c2ccc(C#N)cc2)c(F)c1F |
| InChI | InChI=1S/C26H31F2N3O3/c1-4-32-23-13-10-21(25(27)26(23)28)19-31(22-11-8-20(18-29)9-12-22)16-14-24(33-5-2)34-17-7-6-15-30-3/h8-13,24,30H,4-5,14-17,19H2,1-3H3/t24-/m1/s1 |
| InChIKey | XJWQPTFIVZNQGC-XMMPIXPASA-N |
| XLogP | 4.23 |
| TPSA | 66.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|