C14H18N2O3 — CID 78909770
4-cyano-N-(2,2-diethoxyethyl)benzamide (PubChem CID 78909770) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-cyano-N-(2,2-diethoxyethyl)benzamide.
| Compound Name | 4-cyano-N-(2,2-diethoxyethyl)benzamide |
|---|---|
| PubChem CID | 78909770 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-cyano-N-(2,2-diethoxyethyl)benzamide |
| SMILES | CCOC(CNC(=O)c1ccc(C#N)cc1)OCC |
| InChI | InChI=1S/C14H18N2O3/c1-3-18-13(19-4-2)10-16-14(17)12-7-5-11(9-15)6-8-12/h5-8,13H,3-4,10H2,1-2H3,(H,16,17) |
| InChIKey | PHPFAAPDORTCIA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|