C40H37FN2O3 — CID 68813196
(5-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)-(4-phenyl-1-tritylimidazol-2-yl)methanol (PubChem CID 68813196) has the molecular formula C40H37FN2O3 and a molecular weight of 612.75 g/mol. Its IUPAC name is (5-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)-(4-phenyl-1-tritylimidazol-2-yl)methanol.
| Compound Name | (5-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)-(4-phenyl-1-tritylimidazol-2-yl)methanol |
|---|---|
| PubChem CID | 68813196 |
| Molecular Formula | C40H37FN2O3 |
| Molecular Weight | 612.75 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | (5-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)-(4-phenyl-1-tritylimidazol-2-yl)methanol |
| SMILES | CCOc1cc(OC(C)C)c(F)c(C(O)c2nc(-c3ccccc3)cn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C40H37FN2O3/c1-4-45-33-25-34(37(41)36(26-33)46-28(2)3)38(44)39-42-35(29-17-9-5-10-18-29)27-43(39)40(30-19-11-6-12-20-30,31-21-13-7-14-22-31)32-23-15-8-16-24-32/h5-28,38,44H,4H2,1-3H3 |
| InChIKey | FHYGDFBUEISCAG-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.75 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|