C48H43FN4O2 — CID 68815614
4-[[(5-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)-(5-methyl-4-phenyl-1-tritylimidazol-2-yl)methyl]amino]benzonitrile (PubChem CID 68815614) has the molecular formula C48H43FN4O2 and a molecular weight of 726.90 g/mol. Its IUPAC name is 4-[[(5-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)-(5-methyl-4-phenyl-1-tritylimidazol-2-yl)methyl]amino]benzonitrile.
| Compound Name | 4-[[(5-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)-(5-methyl-4-phenyl-1-tritylimidazol-2-yl)methyl]amino]benzonitrile |
|---|---|
| PubChem CID | 68815614 |
| Molecular Formula | C48H43FN4O2 |
| Molecular Weight | 726.90 g/mol |
| Exact Mass | 726.34 |
| IUPAC Name | 4-[[(5-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)-(5-methyl-4-phenyl-1-tritylimidazol-2-yl)methyl]amino]benzonitrile |
| SMILES | CCOc1cc(OC(C)C)c(F)c(C(Nc2ccc(C#N)cc2)c2nc(-c3ccccc3)c(C)n2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C48H43FN4O2/c1-5-54-41-30-42(44(49)43(31-41)55-33(2)3)46(51-40-28-26-35(32-50)27-29-40)47-52-45(36-18-10-6-11-19-36)34(4)53(47)48(37-20-12-7-13-21-37,38-22-14-8-15-23-38)39-24-16-9-17-25-39/h6-31,33,46,51H,5H2,1-4H3 |
| InChIKey | QHRJSGWHCZHBIH-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 72.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.90 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|