C23H30FN3O5 — CID 90942637
butyl 2-(3,5-diethoxy-2-fluorophenyl)-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate (PubChem CID 90942637) has the molecular formula C23H30FN3O5 and a molecular weight of 447.51 g/mol. Its IUPAC name is butyl 2-(3,5-diethoxy-2-fluorophenyl)-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate.
| Compound Name | butyl 2-(3,5-diethoxy-2-fluorophenyl)-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate |
|---|---|
| PubChem CID | 90942637 |
| Molecular Formula | C23H30FN3O5 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | butyl 2-(3,5-diethoxy-2-fluorophenyl)-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate |
| SMILES | CCCCOC(=O)C(Nc1ccc(C(N)=NO)cc1)c1cc(OCC)cc(OCC)c1F |
| InChI | InChI=1S/C23H30FN3O5/c1-4-7-12-32-23(28)21(26-16-10-8-15(9-11-16)22(25)27-29)18-13-17(30-5-2)14-19(20(18)24)31-6-3/h8-11,13-14,21,26,29H,4-7,12H2,1-3H3,(H2,25,27) |
| InChIKey | RQIGLBUIHSQYMA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|