C29H39N3O8 — CID 22040031
5-[4-ethoxy-2-[2-ethoxy-1-[4-[(E)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]anilino]-2-oxoethyl]phenoxy]pentanoic acid (PubChem CID 22040031) has the molecular formula C29H39N3O8 and a molecular weight of 557.64 g/mol. Its IUPAC name is 5-[4-ethoxy-2-[2-ethoxy-1-[4-[(E)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]anilino]-2-oxoethyl]phenoxy]pentanoic acid.
| Compound Name | 5-[4-ethoxy-2-[2-ethoxy-1-[4-[(E)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]anilino]-2-oxoethyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 22040031 |
| Molecular Formula | C29H39N3O8 |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | 5-[4-ethoxy-2-[2-ethoxy-1-[4-[(E)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]anilino]-2-oxoethyl]phenoxy]pentanoic acid |
| SMILES | CCOC(=O)C(Nc1ccc(/C(N)=N\C(=O)OC(C)(C)C)cc1)c1cc(OCC)ccc1OCCCCC(=O)O |
| InChI | InChI=1S/C29H39N3O8/c1-6-37-21-15-16-23(39-17-9-8-10-24(33)34)22(18-21)25(27(35)38-7-2)31-20-13-11-19(12-14-20)26(30)32-28(36)40-29(3,4)5/h11-16,18,25,31H,6-10,17H2,1-5H3,(H,33,34)(H2,30,32,36) |
| InChIKey | JFNUOJIISKFZPV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 158.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|