C22H23Cl3FN3O7 — CID 22871022
(2S)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-[(Z)-N'-(2,2,2-trichloroethoxycarbonyl)carbamimidoyl]anilino]acetic acid (PubChem CID 22871022) has the molecular formula C22H23Cl3FN3O7 and a molecular weight of 566.80 g/mol. Its IUPAC name is (2S)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-[(Z)-N'-(2,2,2-trichloroethoxycarbonyl)carbamimidoyl]anilino]acetic acid.
| Compound Name | (2S)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-[(Z)-N'-(2,2,2-trichloroethoxycarbonyl)carbamimidoyl]anilino]acetic acid |
|---|---|
| PubChem CID | 22871022 |
| Molecular Formula | C22H23Cl3FN3O7 |
| Molecular Weight | 566.80 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | (2S)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-[(Z)-N'-(2,2,2-trichloroethoxycarbonyl)carbamimidoyl]anilino]acetic acid |
| SMILES | CCOc1cc([C@H](Nc2ccc(/C(N)=N/C(=O)OCC(Cl)(Cl)Cl)cc2)C(=O)O)c(F)cc1OCCO |
| InChI | InChI=1S/C22H23Cl3FN3O7/c1-2-34-16-9-14(15(26)10-17(16)35-8-7-30)18(20(31)32)28-13-5-3-12(4-6-13)19(27)29-21(33)36-11-22(23,24)25/h3-6,9-10,18,28,30H,2,7-8,11H2,1H3,(H,31,32)(H2,27,29,33)/t18-/m0/s1 |
| InChIKey | MNAQREGUIVNEHY-SFHVURJKSA-N |
| XLogP | 4.05 |
| TPSA | 152.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|