C24H31FN4O7 — CID 70003925
ethyl (2R)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-[(ethylcarbamoyloxyhydrazinylidene)methyl]anilino]acetate (PubChem CID 70003925) has the molecular formula C24H31FN4O7 and a molecular weight of 506.53 g/mol. Its IUPAC name is ethyl (2R)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-[(ethylcarbamoyloxyhydrazinylidene)methyl]anilino]acetate.
| Compound Name | ethyl (2R)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-[(ethylcarbamoyloxyhydrazinylidene)methyl]anilino]acetate |
|---|---|
| PubChem CID | 70003925 |
| Molecular Formula | C24H31FN4O7 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | ethyl (2R)-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-[(ethylcarbamoyloxyhydrazinylidene)methyl]anilino]acetate |
| SMILES | CCNC(=O)ONN=Cc1ccc(N[C@@H](C(=O)OCC)c2cc(OCC)c(OCCO)cc2F)cc1 |
| InChI | InChI=1S/C24H31FN4O7/c1-4-26-24(32)36-29-27-15-16-7-9-17(10-8-16)28-22(23(31)34-6-3)18-13-20(33-5-2)21(14-19(18)25)35-12-11-30/h7-10,13-15,22,28-30H,4-6,11-12H2,1-3H3,(H,26,32)/t22-/m1/s1 |
| InChIKey | UTTJWSWGMWJQCS-JOCHJYFZSA-N |
| XLogP | 2.90 |
| TPSA | 139.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|