C28H30FN3O6 — CID 149431744
ethyl (2R)-2-[4-(N-benzoylcarbamimidoyl)anilino]-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]acetate (PubChem CID 149431744) has the molecular formula C28H30FN3O6 and a molecular weight of 523.56 g/mol. Its IUPAC name is ethyl (2R)-2-[4-(N-benzoylcarbamimidoyl)anilino]-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]acetate.
| Compound Name | ethyl (2R)-2-[4-(N-benzoylcarbamimidoyl)anilino]-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 149431744 |
| Molecular Formula | C28H30FN3O6 |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | ethyl (2R)-2-[4-(N-benzoylcarbamimidoyl)anilino]-2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]acetate |
| SMILES | [H]/N=C(\NC(=O)c1ccccc1)c1ccc(N[C@@H](C(=O)OCC)c2cc(OCC)c(OCCO)cc2F)cc1 |
| InChI | InChI=1S/C28H30FN3O6/c1-3-36-23-16-21(22(29)17-24(23)38-15-14-33)25(28(35)37-4-2)31-20-12-10-18(11-13-20)26(30)32-27(34)19-8-6-5-7-9-19/h5-13,16-17,25,31,33H,3-4,14-15H2,1-2H3,(H2,30,32,34)/t25-/m1/s1 |
| InChIKey | SZVXFIATBBBFJY-RUZDIDTESA-N |
| XLogP | 4.07 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|