C32H44FN3O7 — CID 173241334
ethyl 2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-[N-[1-(2-methylpropyl)cyclohexyl]oxycarbonylcarbamimidoyl]anilino]acetate (PubChem CID 173241334) has the molecular formula C32H44FN3O7 and a molecular weight of 601.72 g/mol. Its IUPAC name is ethyl 2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-[N-[1-(2-methylpropyl)cyclohexyl]oxycarbonylcarbamimidoyl]anilino]acetate.
| Compound Name | ethyl 2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-[N-[1-(2-methylpropyl)cyclohexyl]oxycarbonylcarbamimidoyl]anilino]acetate |
|---|---|
| PubChem CID | 173241334 |
| Molecular Formula | C32H44FN3O7 |
| Molecular Weight | 601.72 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | ethyl 2-[5-ethoxy-2-fluoro-4-(2-hydroxyethoxy)phenyl]-2-[4-[N-[1-(2-methylpropyl)cyclohexyl]oxycarbonylcarbamimidoyl]anilino]acetate |
| SMILES | [H]/N=C(\NC(=O)OC1(CC(C)C)CCCCC1)c1ccc(NC(C(=O)OCC)c2cc(OCC)c(OCCO)cc2F)cc1 |
| InChI | InChI=1S/C32H44FN3O7/c1-5-40-26-18-24(25(33)19-27(26)42-17-16-37)28(30(38)41-6-2)35-23-12-10-22(11-13-23)29(34)36-31(39)43-32(20-21(3)4)14-8-7-9-15-32/h10-13,18-19,21,28,35,37H,5-9,14-17,20H2,1-4H3,(H2,34,36,39) |
| InChIKey | IESJEIBJMYHYBB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|