2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid

C17H15BrN2O4 — CID 22039511

IUPAC2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid
SMILESCOc1cc(Br)c(C(Nc2ccc(C#N)cc2)C(=O)O)cc1OC
InChIInChI=1S/C17H15BrN2O4/c1-23-14-7-12(13(18)8-15(14)24-2)16(17(21)22)20-11-5-3-10(9-19)4-6-11/h3-8,16,20H,1-2H3,(H,21,22)
InChIKeyYEYQZWDUIUYYCO-UHFFFAOYSA-N
MW391.22 g/mol
LogP3.58
Rot. Bonds6

About 2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid

2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid (PubChem CID 22039511) has the molecular formula C17H15BrN2O4 and a molecular weight of 391.22 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid.

Molecular Properties

Compound Name2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid
PubChem CID22039511
Molecular FormulaC17H15BrN2O4
Molecular Weight391.22 g/mol
Exact Mass390.02
IUPAC Name2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid
SMILESCOc1cc(Br)c(C(Nc2ccc(C#N)cc2)C(=O)O)cc1OC
InChIInChI=1S/C17H15BrN2O4/c1-23-14-7-12(13(18)8-15(14)24-2)16(17(21)22)20-11-5-3-10(9-19)4-6-11/h3-8,16,20H,1-2H3,(H,21,22)
InChIKeyYEYQZWDUIUYYCO-UHFFFAOYSA-N
XLogP3.58
TPSA91.58 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500391.22
LogP ≤ 53.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid?
The IUPAC name of 2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid (CID 22039511) is 2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid.
What is the SMILES notation for 2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid?
The canonical SMILES for 2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid is COc1cc(Br)c(C(Nc2ccc(C#N)cc2)C(=O)O)cc1OC.
What is the InChIKey of 2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid?
The InChIKey is YEYQZWDUIUYYCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrN2O4/c1-23-14-7-12(13(18)8-15(14)24-2)16(17(21)22)20-11-5-3-10(9-19)4-6-11/h3-8,16,20H,1-2H3,(H,21,22).
What are the key properties of 2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid?
2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid has a molecular weight of 391.22 g/mol, XLogP of 3.58, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-4,5-dimethoxyphenyl)-2-(4-cyanoanilino)acetic acid is sourced from PubChem (CID 22039511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).