C14H20BrNO4 — CID 61024269
2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid (PubChem CID 61024269) has the molecular formula C14H20BrNO4 and a molecular weight of 346.22 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid.
| Compound Name | 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid |
|---|---|
| PubChem CID | 61024269 |
| Molecular Formula | C14H20BrNO4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid |
| SMILES | CCC(C)NC(C(=O)O)c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C14H20BrNO4/c1-5-8(2)16-13(14(17)18)9-6-11(19-3)12(20-4)7-10(9)15/h6-8,13,16H,5H2,1-4H3,(H,17,18) |
| InChIKey | LJQWZJXJWJWIDF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |