2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid

C14H20BrNO4 — CID 61024269

IUPAC2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid
SMILESCCC(C)NC(C(=O)O)c1cc(OC)c(OC)cc1Br
InChIInChI=1S/C14H20BrNO4/c1-5-8(2)16-13(14(17)18)9-6-11(19-3)12(20-4)7-10(9)15/h6-8,13,16H,5H2,1-4H3,(H,17,18)
InChIKeyLJQWZJXJWJWIDF-UHFFFAOYSA-N
MW346.22 g/mol
LogP2.98
Rot. Bonds7

About 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid

2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid (PubChem CID 61024269) has the molecular formula C14H20BrNO4 and a molecular weight of 346.22 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid.

Molecular Properties

Compound Name2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid
PubChem CID61024269
Molecular FormulaC14H20BrNO4
Molecular Weight346.22 g/mol
Exact Mass345.06
IUPAC Name2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid
SMILESCCC(C)NC(C(=O)O)c1cc(OC)c(OC)cc1Br
InChIInChI=1S/C14H20BrNO4/c1-5-8(2)16-13(14(17)18)9-6-11(19-3)12(20-4)7-10(9)15/h6-8,13,16H,5H2,1-4H3,(H,17,18)
InChIKeyLJQWZJXJWJWIDF-UHFFFAOYSA-N
XLogP2.98
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500346.22
LogP ≤ 52.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid?
The IUPAC name of 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid (CID 61024269) is 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid.
What is the SMILES notation for 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid?
The canonical SMILES for 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid is CCC(C)NC(C(=O)O)c1cc(OC)c(OC)cc1Br.
What is the InChIKey of 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid?
The InChIKey is LJQWZJXJWJWIDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrNO4/c1-5-8(2)16-13(14(17)18)9-6-11(19-3)12(20-4)7-10(9)15/h6-8,13,16H,5H2,1-4H3,(H,17,18).
What are the key properties of 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid?
2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid has a molecular weight of 346.22 g/mol, XLogP of 2.98, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-4,5-dimethoxyphenyl)-2-(butan-2-ylamino)acetic acid is sourced from PubChem (CID 61024269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).