2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid

C14H21NO2 — CID 54977951

IUPAC2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid
SMILESCCC(C)NC(C(=O)O)c1cc(C)ccc1C
InChIInChI=1S/C14H21NO2/c1-5-11(4)15-13(14(16)17)12-8-9(2)6-7-10(12)3/h6-8,11,13,15H,5H2,1-4H3,(H,16,17)
InChIKeyYFMZVEYFLSLPQF-UHFFFAOYSA-N
MW235.33 g/mol
LogP2.82
Rot. Bonds5

About 2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid

2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid (PubChem CID 54977951) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid.

Molecular Properties

Compound Name2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid
PubChem CID54977951
Molecular FormulaC14H21NO2
Molecular Weight235.33 g/mol
Exact Mass235.16
IUPAC Name2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid
SMILESCCC(C)NC(C(=O)O)c1cc(C)ccc1C
InChIInChI=1S/C14H21NO2/c1-5-11(4)15-13(14(16)17)12-8-9(2)6-7-10(12)3/h6-8,11,13,15H,5H2,1-4H3,(H,16,17)
InChIKeyYFMZVEYFLSLPQF-UHFFFAOYSA-N
XLogP2.82
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.33
LogP ≤ 52.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid?
The IUPAC name of 2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid (CID 54977951) is 2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid.
What is the SMILES notation for 2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid?
The canonical SMILES for 2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid is CCC(C)NC(C(=O)O)c1cc(C)ccc1C.
What is the InChIKey of 2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid?
The InChIKey is YFMZVEYFLSLPQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-5-11(4)15-13(14(16)17)12-8-9(2)6-7-10(12)3/h6-8,11,13,15H,5H2,1-4H3,(H,16,17).
What are the key properties of 2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid?
2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid has a molecular weight of 235.33 g/mol, XLogP of 2.82, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butan-2-ylamino)-2-(2,5-dimethylphenyl)acetic acid is sourced from PubChem (CID 54977951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).