C12H18BrNO2 — CID 115929935
2-bromo-N-butan-2-yl-4,5-dimethoxyaniline (PubChem CID 115929935) has the molecular formula C12H18BrNO2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 2-bromo-N-butan-2-yl-4,5-dimethoxyaniline.
| Compound Name | 2-bromo-N-butan-2-yl-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 115929935 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-bromo-N-butan-2-yl-4,5-dimethoxyaniline |
| SMILES | CCC(C)Nc1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C12H18BrNO2/c1-5-8(2)14-10-7-12(16-4)11(15-3)6-9(10)13/h6-8,14H,5H2,1-4H3 |
| InChIKey | QFUXJOVOPRXLNZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|