C17H16N2O3 — CID 22038965
2-(4-cyanoanilino)-2-(5-ethyl-2-hydroxyphenyl)acetic acid (PubChem CID 22038965) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-(5-ethyl-2-hydroxyphenyl)acetic acid.
| Compound Name | 2-(4-cyanoanilino)-2-(5-ethyl-2-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 22038965 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-(4-cyanoanilino)-2-(5-ethyl-2-hydroxyphenyl)acetic acid |
| SMILES | CCc1ccc(O)c(C(Nc2ccc(C#N)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C17H16N2O3/c1-2-11-5-8-15(20)14(9-11)16(17(21)22)19-13-6-3-12(10-18)4-7-13/h3-9,16,19-20H,2H2,1H3,(H,21,22) |
| InChIKey | OHRABJOINWZKDB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|