C17H14N2O5 — CID 22039162
3-[carboxy-(4-cyanoanilino)methyl]-5-(hydroxymethyl)benzoic acid (PubChem CID 22039162) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 3-[carboxy-(4-cyanoanilino)methyl]-5-(hydroxymethyl)benzoic acid.
| Compound Name | 3-[carboxy-(4-cyanoanilino)methyl]-5-(hydroxymethyl)benzoic acid |
|---|---|
| PubChem CID | 22039162 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-[carboxy-(4-cyanoanilino)methyl]-5-(hydroxymethyl)benzoic acid |
| SMILES | N#Cc1ccc(NC(C(=O)O)c2cc(CO)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C17H14N2O5/c18-8-10-1-3-14(4-2-10)19-15(17(23)24)12-5-11(9-20)6-13(7-12)16(21)22/h1-7,15,19-20H,9H2,(H,21,22)(H,23,24) |
| InChIKey | FNJNZIIIXMRNBT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |