C15H12N2O5 — CID 22665972
5-[carboxy-(4-cyanoanilino)methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 22665972) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is 5-[carboxy-(4-cyanoanilino)methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[carboxy-(4-cyanoanilino)methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 22665972 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 5-[carboxy-(4-cyanoanilino)methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(C(Nc2ccc(C#N)cc2)C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C15H12N2O5/c1-8-11(14(18)19)6-12(22-8)13(15(20)21)17-10-4-2-9(7-16)3-5-10/h2-6,13,17H,1H3,(H,18,19)(H,20,21) |
| InChIKey | HEWIHYGMMQXTRB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |