C25H24N3O5S- — CID 22040156
2-[2-[2-(benzenesulfonamido)ethoxy]-5-ethylphenyl]-2-(4-cyanoanilino)acetate (PubChem CID 22040156) has the molecular formula C25H24N3O5S- and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[2-[2-(benzenesulfonamido)ethoxy]-5-ethylphenyl]-2-(4-cyanoanilino)acetate.
| Compound Name | 2-[2-[2-(benzenesulfonamido)ethoxy]-5-ethylphenyl]-2-(4-cyanoanilino)acetate |
|---|---|
| PubChem CID | 22040156 |
| Molecular Formula | C25H24N3O5S- |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[2-[2-(benzenesulfonamido)ethoxy]-5-ethylphenyl]-2-(4-cyanoanilino)acetate |
| SMILES | CCc1ccc(OCCNS(=O)(=O)c2ccccc2)c(C(Nc2ccc(C#N)cc2)C(=O)[O-])c1 |
| InChI | InChI=1S/C25H25N3O5S/c1-2-18-10-13-23(33-15-14-27-34(31,32)21-6-4-3-5-7-21)22(16-18)24(25(29)30)28-20-11-8-19(17-26)9-12-20/h3-13,16,24,27-28H,2,14-15H2,1H3,(H,29,30)/p-1 |
| InChIKey | ZLTQCBDBKRJOBA-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|