C23H20N3O4- — CID 22039774
2-(2-amino-5-methoxy-4-phenylmethoxyphenyl)-2-(4-cyanoanilino)acetate (PubChem CID 22039774) has the molecular formula C23H20N3O4- and a molecular weight of 402.43 g/mol. Its IUPAC name is 2-(2-amino-5-methoxy-4-phenylmethoxyphenyl)-2-(4-cyanoanilino)acetate.
| Compound Name | 2-(2-amino-5-methoxy-4-phenylmethoxyphenyl)-2-(4-cyanoanilino)acetate |
|---|---|
| PubChem CID | 22039774 |
| Molecular Formula | C23H20N3O4- |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-(2-amino-5-methoxy-4-phenylmethoxyphenyl)-2-(4-cyanoanilino)acetate |
| SMILES | COc1cc(C(Nc2ccc(C#N)cc2)C(=O)[O-])c(N)cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H21N3O4/c1-29-20-11-18(19(25)12-21(20)30-14-16-5-3-2-4-6-16)22(23(27)28)26-17-9-7-15(13-24)8-10-17/h2-12,22,26H,14,25H2,1H3,(H,27,28)/p-1 |
| InChIKey | DCZVMFZCOUAYKX-UHFFFAOYSA-M |
| XLogP | 2.63 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|