C21H17N2O4S- — CID 22039462
2-(4-cyanoanilino)-2-(4,5-dimethoxy-2-thiophen-3-ylphenyl)acetate (PubChem CID 22039462) has the molecular formula C21H17N2O4S- and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-(4,5-dimethoxy-2-thiophen-3-ylphenyl)acetate.
| Compound Name | 2-(4-cyanoanilino)-2-(4,5-dimethoxy-2-thiophen-3-ylphenyl)acetate |
|---|---|
| PubChem CID | 22039462 |
| Molecular Formula | C21H17N2O4S- |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-(4-cyanoanilino)-2-(4,5-dimethoxy-2-thiophen-3-ylphenyl)acetate |
| SMILES | COc1cc(-c2ccsc2)c(C(Nc2ccc(C#N)cc2)C(=O)[O-])cc1OC |
| InChI | InChI=1S/C21H18N2O4S/c1-26-18-9-16(14-7-8-28-12-14)17(10-19(18)27-2)20(21(24)25)23-15-5-3-13(11-22)4-6-15/h3-10,12,20,23H,1-2H3,(H,24,25)/p-1 |
| InChIKey | WLMYJAVSIOBNCK-UHFFFAOYSA-M |
| XLogP | 3.21 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |