C18H17FN2O4 — CID 150167732
[(4-cyanoanilino)-(2-fluoro-4,5-dimethoxyphenyl)methyl] acetate (PubChem CID 150167732) has the molecular formula C18H17FN2O4 and a molecular weight of 344.34 g/mol. Its IUPAC name is [(4-cyanoanilino)-(2-fluoro-4,5-dimethoxyphenyl)methyl] acetate.
| Compound Name | [(4-cyanoanilino)-(2-fluoro-4,5-dimethoxyphenyl)methyl] acetate |
|---|---|
| PubChem CID | 150167732 |
| Molecular Formula | C18H17FN2O4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [(4-cyanoanilino)-(2-fluoro-4,5-dimethoxyphenyl)methyl] acetate |
| SMILES | COc1cc(F)c(C(Nc2ccc(C#N)cc2)OC(C)=O)cc1OC |
| InChI | InChI=1S/C18H17FN2O4/c1-11(22)25-18(21-13-6-4-12(10-20)5-7-13)14-8-16(23-2)17(24-3)9-15(14)19/h4-9,18,21H,1-3H3 |
| InChIKey | FITJGZHJDGNXAU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|