C31H28BF3N3O4- — CID 22038882
N-benzyl-2-(4-cyanoanilino)-2-(4,5-dimethoxy-2-phenylmethoxyphenyl)ethanimidate;trifluoroborane (PubChem CID 22038882) has the molecular formula C31H28BF3N3O4- and a molecular weight of 574.39 g/mol. Its IUPAC name is N-benzyl-2-(4-cyanoanilino)-2-(4,5-dimethoxy-2-phenylmethoxyphenyl)ethanimidate;trifluoroborane.
| Compound Name | N-benzyl-2-(4-cyanoanilino)-2-(4,5-dimethoxy-2-phenylmethoxyphenyl)ethanimidate;trifluoroborane |
|---|---|
| PubChem CID | 22038882 |
| Molecular Formula | C31H28BF3N3O4- |
| Molecular Weight | 574.39 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | N-benzyl-2-(4-cyanoanilino)-2-(4,5-dimethoxy-2-phenylmethoxyphenyl)ethanimidate;trifluoroborane |
| SMILES | COc1cc(OCc2ccccc2)c(C(Nc2ccc(C#N)cc2)/C([O-])=N/Cc2ccccc2)cc1OC.FB(F)F |
| InChI | InChI=1S/C31H29N3O4.BF3/c1-36-28-17-26(27(18-29(28)37-2)38-21-24-11-7-4-8-12-24)30(34-25-15-13-22(19-32)14-16-25)31(35)33-20-23-9-5-3-6-10-23;2-1(3)4/h3-18,30,34H,20-21H2,1-2H3,(H,33,35);/p-1 |
| InChIKey | ZJEBOYGLBTXNJL-UHFFFAOYSA-M |
| XLogP | 6.15 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.39 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|