C22H23N2O4- — CID 22038711
2-(4-cyanoanilino)-2-[5-ethyl-2-(2-hydroxyethoxy)-3-prop-2-enylphenyl]acetate (PubChem CID 22038711) has the molecular formula C22H23N2O4- and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-[5-ethyl-2-(2-hydroxyethoxy)-3-prop-2-enylphenyl]acetate.
| Compound Name | 2-(4-cyanoanilino)-2-[5-ethyl-2-(2-hydroxyethoxy)-3-prop-2-enylphenyl]acetate |
|---|---|
| PubChem CID | 22038711 |
| Molecular Formula | C22H23N2O4- |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-(4-cyanoanilino)-2-[5-ethyl-2-(2-hydroxyethoxy)-3-prop-2-enylphenyl]acetate |
| SMILES | C=CCc1cc(CC)cc(C(Nc2ccc(C#N)cc2)C(=O)[O-])c1OCCO |
| InChI | InChI=1S/C22H24N2O4/c1-3-5-17-12-15(4-2)13-19(21(17)28-11-10-25)20(22(26)27)24-18-8-6-16(14-23)7-9-18/h3,6-9,12-13,20,24-25H,1,4-5,10-11H2,2H3,(H,26,27)/p-1 |
| InChIKey | KHUYWDDGKLXRHL-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|