C21H23N2O4- — CID 22039740
2-(4-cyanoanilino)-2-[2-(2-hydroxyethoxy)-5-methyl-3-propylphenyl]acetate (PubChem CID 22039740) has the molecular formula C21H23N2O4- and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-[2-(2-hydroxyethoxy)-5-methyl-3-propylphenyl]acetate.
| Compound Name | 2-(4-cyanoanilino)-2-[2-(2-hydroxyethoxy)-5-methyl-3-propylphenyl]acetate |
|---|---|
| PubChem CID | 22039740 |
| Molecular Formula | C21H23N2O4- |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-(4-cyanoanilino)-2-[2-(2-hydroxyethoxy)-5-methyl-3-propylphenyl]acetate |
| SMILES | CCCc1cc(C)cc(C(Nc2ccc(C#N)cc2)C(=O)[O-])c1OCCO |
| InChI | InChI=1S/C21H24N2O4/c1-3-4-16-11-14(2)12-18(20(16)27-10-9-24)19(21(25)26)23-17-7-5-15(13-22)6-8-17/h5-8,11-12,19,23-24H,3-4,9-10H2,1-2H3,(H,25,26)/p-1 |
| InChIKey | QMDSVOXNZBSJPO-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |