C26H24N3O4- — CID 23283305
2-[2-[2-(benzylamino)-1-(4-cyanoanilino)-2-oxoethyl]-4,6-dimethylphenoxy]acetate (PubChem CID 23283305) has the molecular formula C26H24N3O4- and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-[2-[2-(benzylamino)-1-(4-cyanoanilino)-2-oxoethyl]-4,6-dimethylphenoxy]acetate.
| Compound Name | 2-[2-[2-(benzylamino)-1-(4-cyanoanilino)-2-oxoethyl]-4,6-dimethylphenoxy]acetate |
|---|---|
| PubChem CID | 23283305 |
| Molecular Formula | C26H24N3O4- |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-[2-[2-(benzylamino)-1-(4-cyanoanilino)-2-oxoethyl]-4,6-dimethylphenoxy]acetate |
| SMILES | Cc1cc(C)c(OCC(=O)[O-])c(C(Nc2ccc(C#N)cc2)C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C26H25N3O4/c1-17-12-18(2)25(33-16-23(30)31)22(13-17)24(29-21-10-8-19(14-27)9-11-21)26(32)28-15-20-6-4-3-5-7-20/h3-13,24,29H,15-16H2,1-2H3,(H,28,32)(H,30,31)/p-1 |
| InChIKey | HXPJRHVBZDCQGG-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |