C20H21N2O3- — CID 22038924
2-(4-cyanoanilino)-2-(5-ethyl-2-hydroxy-3-propylphenyl)acetate (PubChem CID 22038924) has the molecular formula C20H21N2O3- and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-(5-ethyl-2-hydroxy-3-propylphenyl)acetate.
| Compound Name | 2-(4-cyanoanilino)-2-(5-ethyl-2-hydroxy-3-propylphenyl)acetate |
|---|---|
| PubChem CID | 22038924 |
| Molecular Formula | C20H21N2O3- |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-(4-cyanoanilino)-2-(5-ethyl-2-hydroxy-3-propylphenyl)acetate |
| SMILES | CCCc1cc(CC)cc(C(Nc2ccc(C#N)cc2)C(=O)[O-])c1O |
| InChI | InChI=1S/C20H22N2O3/c1-3-5-15-10-13(4-2)11-17(19(15)23)18(20(24)25)22-16-8-6-14(12-21)7-9-16/h6-11,18,22-23H,3-5H2,1-2H3,(H,24,25)/p-1 |
| InChIKey | IVKYWUJGKNUBEQ-UHFFFAOYSA-M |
| XLogP | 2.68 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|