C22H26N2O3 — CID 54422770
2-(4-cyanoanilino)-2-[5-ethyl-2-hydroxy-3-(2-methylpropyl)phenyl]propanoic acid (PubChem CID 54422770) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-[5-ethyl-2-hydroxy-3-(2-methylpropyl)phenyl]propanoic acid.
| Compound Name | 2-(4-cyanoanilino)-2-[5-ethyl-2-hydroxy-3-(2-methylpropyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 54422770 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-(4-cyanoanilino)-2-[5-ethyl-2-hydroxy-3-(2-methylpropyl)phenyl]propanoic acid |
| SMILES | CCc1cc(CC(C)C)c(O)c(C(C)(Nc2ccc(C#N)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-5-15-11-17(10-14(2)3)20(25)19(12-15)22(4,21(26)27)24-18-8-6-16(13-23)7-9-18/h6-9,11-12,14,24-25H,5,10H2,1-4H3,(H,26,27) |
| InChIKey | WBYQFJQXZUYOBA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|