C18H16I2N2O4 — CID 90815896
2-(4-cyanoanilino)-2-[2-(2-hydroxyethoxy)-3,5-diiodophenyl]propanoic acid (PubChem CID 90815896) has the molecular formula C18H16I2N2O4 and a molecular weight of 578.14 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-[2-(2-hydroxyethoxy)-3,5-diiodophenyl]propanoic acid.
| Compound Name | 2-(4-cyanoanilino)-2-[2-(2-hydroxyethoxy)-3,5-diiodophenyl]propanoic acid |
|---|---|
| PubChem CID | 90815896 |
| Molecular Formula | C18H16I2N2O4 |
| Molecular Weight | 578.14 g/mol |
| Exact Mass | 577.92 |
| IUPAC Name | 2-(4-cyanoanilino)-2-[2-(2-hydroxyethoxy)-3,5-diiodophenyl]propanoic acid |
| SMILES | CC(Nc1ccc(C#N)cc1)(C(=O)O)c1cc(I)cc(I)c1OCCO |
| InChI | InChI=1S/C18H16I2N2O4/c1-18(17(24)25,22-13-4-2-11(10-21)3-5-13)14-8-12(19)9-15(20)16(14)26-7-6-23/h2-5,8-9,22-23H,6-7H2,1H3,(H,24,25) |
| InChIKey | HRQZGWKTAXIQKD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|