C18H18N2O4 — CID 54054061
2-(4-cyanoanilino)-2-(2,5-dimethoxyphenyl)propanoic acid (PubChem CID 54054061) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-2-(2,5-dimethoxyphenyl)propanoic acid.
| Compound Name | 2-(4-cyanoanilino)-2-(2,5-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 54054061 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(4-cyanoanilino)-2-(2,5-dimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc(OC)c(C(C)(Nc2ccc(C#N)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C18H18N2O4/c1-18(17(21)22,20-13-6-4-12(11-19)5-7-13)15-10-14(23-2)8-9-16(15)24-3/h4-10,20H,1-3H3,(H,21,22) |
| InChIKey | LUZHJBFXQYZXRY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |