C27H36N6O6 — CID 142031228
(4S)-5-[(4-aminophenyl)methylamino]-4-[[3-(4-carbamimidoylphenyl)-2-(methylamino)propanoyl]amino]-5-oxopentanoic acid;prop-2-enyl formate (PubChem CID 142031228) has the molecular formula C27H36N6O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is (4S)-5-[(4-aminophenyl)methylamino]-4-[[3-(4-carbamimidoylphenyl)-2-(methylamino)propanoyl]amino]-5-oxopentanoic acid;prop-2-enyl formate.
| Compound Name | (4S)-5-[(4-aminophenyl)methylamino]-4-[[3-(4-carbamimidoylphenyl)-2-(methylamino)propanoyl]amino]-5-oxopentanoic acid;prop-2-enyl formate |
|---|---|
| PubChem CID | 142031228 |
| Molecular Formula | C27H36N6O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | (4S)-5-[(4-aminophenyl)methylamino]-4-[[3-(4-carbamimidoylphenyl)-2-(methylamino)propanoyl]amino]-5-oxopentanoic acid;prop-2-enyl formate |
| SMILES | C=CCOC=O.[H]/N=C(\N)c1ccc(CC(NC)C(=O)N[C@@H](CCC(=O)O)C(=O)NCc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C23H30N6O4.C4H6O2/c1-27-19(12-14-2-6-16(7-3-14)21(25)26)23(33)29-18(10-11-20(30)31)22(32)28-13-15-4-8-17(24)9-5-15;1-2-3-6-4-5/h2-9,18-19,27H,10-13,24H2,1H3,(H3,25,26)(H,28,32)(H,29,33)(H,30,31);2,4H,1,3H2/t18-,19?;/m0./s1 |
| InChIKey | NOMNINITJYLMHY-HMEPSURWSA-N |
| XLogP | 0.69 |
| TPSA | 209.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|