C18H26N6O3 — CID 44587316
(2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-pyrrolidine-2-carbonyl]amino]pentanediamide (PubChem CID 44587316) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-pyrrolidine-2-carbonyl]amino]pentanediamide.
| Compound Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-pyrrolidine-2-carbonyl]amino]pentanediamide |
|---|---|
| PubChem CID | 44587316 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (2S)-N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-pyrrolidine-2-carbonyl]amino]pentanediamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]2CCCN2)cc1 |
| InChI | InChI=1S/C18H26N6O3/c19-15(25)8-7-14(24-18(27)13-2-1-9-22-13)17(26)23-10-11-3-5-12(6-4-11)16(20)21/h3-6,13-14,22H,1-2,7-10H2,(H2,19,25)(H3,20,21)(H,23,26)(H,24,27)/t13-,14+/m1/s1 |
| InChIKey | AINWHYADATYRIZ-KGLIPLIRSA-N |
| XLogP | -0.91 |
| TPSA | 163.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|