C13H20Cl2N4O — CID 18424074
N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 18424074) has the molecular formula C13H20Cl2N4O and a molecular weight of 319.24 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 18424074 |
| Molecular Formula | C13H20Cl2N4O |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(CNC(=O)C2CCCN2)cc1 |
| InChI | InChI=1S/C13H18N4O.2ClH/c14-12(15)10-5-3-9(4-6-10)8-17-13(18)11-2-1-7-16-11;;/h3-6,11,16H,1-2,7-8H2,(H3,14,15)(H,17,18);2*1H |
| InChIKey | FTNYTRVTCWPEJR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|