C30H35F3N6O6 — CID 70219530
methyl 2-[[2-[(4-carbamimidoylphenyl)methyl]-3-[(4-carbamimidoylphenyl)methylamino]-3-oxopropanoyl]amino]-2-cyclohexyl-2-(2,2,2-trifluoroacetyl)oxyacetate (PubChem CID 70219530) has the molecular formula C30H35F3N6O6 and a molecular weight of 632.64 g/mol. Its IUPAC name is methyl 2-[[2-[(4-carbamimidoylphenyl)methyl]-3-[(4-carbamimidoylphenyl)methylamino]-3-oxopropanoyl]amino]-2-cyclohexyl-2-(2,2,2-trifluoroacetyl)oxyacetate.
| Compound Name | methyl 2-[[2-[(4-carbamimidoylphenyl)methyl]-3-[(4-carbamimidoylphenyl)methylamino]-3-oxopropanoyl]amino]-2-cyclohexyl-2-(2,2,2-trifluoroacetyl)oxyacetate |
|---|---|
| PubChem CID | 70219530 |
| Molecular Formula | C30H35F3N6O6 |
| Molecular Weight | 632.64 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | methyl 2-[[2-[(4-carbamimidoylphenyl)methyl]-3-[(4-carbamimidoylphenyl)methylamino]-3-oxopropanoyl]amino]-2-cyclohexyl-2-(2,2,2-trifluoroacetyl)oxyacetate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(Cc2ccc(/C(N)=N/[H])cc2)C(=O)NC(OC(=O)C(F)(F)F)(C(=O)OC)C2CCCCC2)cc1 |
| InChI | InChI=1S/C30H35F3N6O6/c1-44-27(42)29(21-5-3-2-4-6-21,45-28(43)30(31,32)33)39-26(41)22(15-17-7-11-19(12-8-17)23(34)35)25(40)38-16-18-9-13-20(14-10-18)24(36)37/h7-14,21-22H,2-6,15-16H2,1H3,(H3,34,35)(H3,36,37)(H,38,40)(H,39,41) |
| InChIKey | OTDWKJQUHITMEF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 210.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|