C27H44ClN5O4S — CID 69431243
N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-2-cyclohexyl-2-(cyclohexylmethylsulfonylamino)acetyl]amino]-2-methylpropanamide;hydrochloride (PubChem CID 69431243) has the molecular formula C27H44ClN5O4S and a molecular weight of 570.20 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-2-cyclohexyl-2-(cyclohexylmethylsulfonylamino)acetyl]amino]-2-methylpropanamide;hydrochloride.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-2-cyclohexyl-2-(cyclohexylmethylsulfonylamino)acetyl]amino]-2-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 69431243 |
| Molecular Formula | C27H44ClN5O4S |
| Molecular Weight | 570.20 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[[(2R)-2-cyclohexyl-2-(cyclohexylmethylsulfonylamino)acetyl]amino]-2-methylpropanamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CNC(=O)C(C)(C)NC(=O)[C@H](NS(=O)(=O)CC2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C27H43N5O4S.ClH/c1-27(2,26(34)30-17-19-13-15-22(16-14-19)24(28)29)31-25(33)23(21-11-7-4-8-12-21)32-37(35,36)18-20-9-5-3-6-10-20;/h13-16,20-21,23,32H,3-12,17-18H2,1-2H3,(H3,28,29)(H,30,34)(H,31,33);1H/t23-;/m1./s1 |
| InChIKey | PPUQFBMNZDFJBH-GNAFDRTKSA-N |
| XLogP | 3.35 |
| TPSA | 154.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|