C23H32N4O3 — CID 20684588
(1S,5R)-N-[(4-carbamimidoylphenyl)methyl]-2-[(2R)-3-cyclohexyl-2-hydroxypropanoyl]-2-azabicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 20684588) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is (1S,5R)-N-[(4-carbamimidoylphenyl)methyl]-2-[(2R)-3-cyclohexyl-2-hydroxypropanoyl]-2-azabicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1S,5R)-N-[(4-carbamimidoylphenyl)methyl]-2-[(2R)-3-cyclohexyl-2-hydroxypropanoyl]-2-azabicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 20684588 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (1S,5R)-N-[(4-carbamimidoylphenyl)methyl]-2-[(2R)-3-cyclohexyl-2-hydroxypropanoyl]-2-azabicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@]23C[C@H]2CCN3C(=O)[C@H](O)CC2CCCCC2)cc1 |
| InChI | InChI=1S/C23H32N4O3/c24-20(25)17-8-6-16(7-9-17)14-26-22(30)23-13-18(23)10-11-27(23)21(29)19(28)12-15-4-2-1-3-5-15/h6-9,15,18-19,28H,1-5,10-14H2,(H3,24,25)(H,26,30)/t18-,19-,23+/m1/s1 |
| InChIKey | HLJHCOFBSXPIPE-PWHSHALESA-N |
| XLogP | 1.91 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|