C31H42N6O2 — CID 20684647
(1S,6R)-2-[(2R)-2-(benzylamino)-3-cyclohexylpropanoyl]-N-[[4-(diaminomethylideneamino)phenyl]methyl]-2-azabicyclo[4.1.0]heptane-1-carboxamide (PubChem CID 20684647) has the molecular formula C31H42N6O2 and a molecular weight of 530.72 g/mol. Its IUPAC name is (1S,6R)-2-[(2R)-2-(benzylamino)-3-cyclohexylpropanoyl]-N-[[4-(diaminomethylideneamino)phenyl]methyl]-2-azabicyclo[4.1.0]heptane-1-carboxamide.
| Compound Name | (1S,6R)-2-[(2R)-2-(benzylamino)-3-cyclohexylpropanoyl]-N-[[4-(diaminomethylideneamino)phenyl]methyl]-2-azabicyclo[4.1.0]heptane-1-carboxamide |
|---|---|
| PubChem CID | 20684647 |
| Molecular Formula | C31H42N6O2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | (1S,6R)-2-[(2R)-2-(benzylamino)-3-cyclohexylpropanoyl]-N-[[4-(diaminomethylideneamino)phenyl]methyl]-2-azabicyclo[4.1.0]heptane-1-carboxamide |
| SMILES | NC(N)=Nc1ccc(CNC(=O)[C@]23C[C@H]2CCCN3C(=O)[C@@H](CC2CCCCC2)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H42N6O2/c32-30(33)36-26-15-13-24(14-16-26)21-35-29(39)31-19-25(31)12-7-17-37(31)28(38)27(18-22-8-3-1-4-9-22)34-20-23-10-5-2-6-11-23/h2,5-6,10-11,13-16,22,25,27,34H,1,3-4,7-9,12,17-21H2,(H,35,39)(H4,32,33,36)/t25-,27-,31+/m1/s1 |
| InChIKey | NTZCZUGYEWSAQU-HQTJAOSFSA-N |
| XLogP | 3.72 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|