C22H34N6O3 — CID 140996531
cyclooctyl 4-[[4-(diaminomethylideneamino)phenyl]methylcarbamoyl]piperazine-1-carboxylate (PubChem CID 140996531) has the molecular formula C22H34N6O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is cyclooctyl 4-[[4-(diaminomethylideneamino)phenyl]methylcarbamoyl]piperazine-1-carboxylate.
| Compound Name | cyclooctyl 4-[[4-(diaminomethylideneamino)phenyl]methylcarbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 140996531 |
| Molecular Formula | C22H34N6O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | cyclooctyl 4-[[4-(diaminomethylideneamino)phenyl]methylcarbamoyl]piperazine-1-carboxylate |
| SMILES | NC(N)=Nc1ccc(CNC(=O)N2CCN(C(=O)OC3CCCCCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H34N6O3/c23-20(24)26-18-10-8-17(9-11-18)16-25-21(29)27-12-14-28(15-13-27)22(30)31-19-6-4-2-1-3-5-7-19/h8-11,19H,1-7,12-16H2,(H,25,29)(H4,23,24,26) |
| InChIKey | DBCJCAUXOLQIFH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|