C30H41N5O4S — CID 69427499
1-[[(2R)-2-(benzylsulfonylamino)-2-cyclohexylacetyl]amino]-N-[(4-carbamimidoylphenyl)methyl]cyclohexane-1-carboxamide (PubChem CID 69427499) has the molecular formula C30H41N5O4S and a molecular weight of 567.76 g/mol. Its IUPAC name is 1-[[(2R)-2-(benzylsulfonylamino)-2-cyclohexylacetyl]amino]-N-[(4-carbamimidoylphenyl)methyl]cyclohexane-1-carboxamide.
| Compound Name | 1-[[(2R)-2-(benzylsulfonylamino)-2-cyclohexylacetyl]amino]-N-[(4-carbamimidoylphenyl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 69427499 |
| Molecular Formula | C30H41N5O4S |
| Molecular Weight | 567.76 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | 1-[[(2R)-2-(benzylsulfonylamino)-2-cyclohexylacetyl]amino]-N-[(4-carbamimidoylphenyl)methyl]cyclohexane-1-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C2(NC(=O)[C@H](NS(=O)(=O)Cc3ccccc3)C3CCCCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C30H41N5O4S/c31-27(32)25-16-14-22(15-17-25)20-33-29(37)30(18-8-3-9-19-30)34-28(36)26(24-12-6-2-7-13-24)35-40(38,39)21-23-10-4-1-5-11-23/h1,4-5,10-11,14-17,24,26,35H,2-3,6-9,12-13,18-21H2,(H3,31,32)(H,33,37)(H,34,36)/t26-/m1/s1 |
| InChIKey | WFPAHKNRZKXQNB-AREMUKBSSA-N |
| XLogP | 3.47 |
| TPSA | 154.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.76 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|