C35H34N4O6 — CID 54392113
benzyl 3-[[2-phenyl-3-[[4-(N'-phenylmethoxycarbonylcarbamimidoyl)benzoyl]amino]propanoyl]amino]propanoate (PubChem CID 54392113) has the molecular formula C35H34N4O6 and a molecular weight of 606.68 g/mol. Its IUPAC name is benzyl 3-[[2-phenyl-3-[[4-(N'-phenylmethoxycarbonylcarbamimidoyl)benzoyl]amino]propanoyl]amino]propanoate.
| Compound Name | benzyl 3-[[2-phenyl-3-[[4-(N'-phenylmethoxycarbonylcarbamimidoyl)benzoyl]amino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 54392113 |
| Molecular Formula | C35H34N4O6 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | benzyl 3-[[2-phenyl-3-[[4-(N'-phenylmethoxycarbonylcarbamimidoyl)benzoyl]amino]propanoyl]amino]propanoate |
| SMILES | NC(=NC(=O)OCc1ccccc1)c1ccc(C(=O)NCC(C(=O)NCCC(=O)OCc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H34N4O6/c36-32(39-35(43)45-24-26-12-6-2-7-13-26)28-16-18-29(19-17-28)33(41)38-22-30(27-14-8-3-9-15-27)34(42)37-21-20-31(40)44-23-25-10-4-1-5-11-25/h1-19,30H,20-24H2,(H,37,42)(H,38,41)(H2,36,39,43) |
| InChIKey | VHJIEPQFIGQCBE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|