C30H33N5O5 — CID 57366108
benzyl N-[amino-[4-[[[2-[(2S)-3-oxo-4-(2-phenylethylamino)morpholin-2-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 57366108) has the molecular formula C30H33N5O5 and a molecular weight of 543.62 g/mol. Its IUPAC name is benzyl N-[amino-[4-[[[2-[(2S)-3-oxo-4-(2-phenylethylamino)morpholin-2-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[4-[[[2-[(2S)-3-oxo-4-(2-phenylethylamino)morpholin-2-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 57366108 |
| Molecular Formula | C30H33N5O5 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | benzyl N-[amino-[4-[[[2-[(2S)-3-oxo-4-(2-phenylethylamino)morpholin-2-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | NC(=NC(=O)OCc1ccccc1)c1ccc(CNC(=O)C[C@@H]2OCCN(NCCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C30H33N5O5/c31-28(34-30(38)40-21-24-9-5-2-6-10-24)25-13-11-23(12-14-25)20-32-27(36)19-26-29(37)35(17-18-39-26)33-16-15-22-7-3-1-4-8-22/h1-14,26,33H,15-21H2,(H,32,36)(H2,31,34,38)/t26-/m0/s1 |
| InChIKey | VQEITOWMUMDRGD-SANMLTNESA-N |
| XLogP | 2.71 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|