C21H23N5O4 — CID 11730366
N-[(2R)-2-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-oxomorpholin-4-yl]benzamide (PubChem CID 11730366) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[(2R)-2-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-oxomorpholin-4-yl]benzamide.
| Compound Name | N-[(2R)-2-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-oxomorpholin-4-yl]benzamide |
|---|---|
| PubChem CID | 11730366 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-[(2R)-2-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-oxomorpholin-4-yl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C[C@H]2OCCN(NC(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C21H23N5O4/c22-19(23)15-8-6-14(7-9-15)13-24-18(27)12-17-21(29)26(10-11-30-17)25-20(28)16-4-2-1-3-5-16/h1-9,17H,10-13H2,(H3,22,23)(H,24,27)(H,25,28)/t17-/m1/s1 |
| InChIKey | YQSBYVSUIBXPKH-QGZVFWFLSA-N |
| XLogP | 0.55 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|