C21H24N6O4 — CID 54587541
4-amino-N-[(2R)-2-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-oxomorpholin-4-yl]benzamide (PubChem CID 54587541) has the molecular formula C21H24N6O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 4-amino-N-[(2R)-2-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-oxomorpholin-4-yl]benzamide.
| Compound Name | 4-amino-N-[(2R)-2-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-oxomorpholin-4-yl]benzamide |
|---|---|
| PubChem CID | 54587541 |
| Molecular Formula | C21H24N6O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-amino-N-[(2R)-2-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-oxomorpholin-4-yl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C[C@H]2OCCN(NC(=O)c3ccc(N)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H24N6O4/c22-16-7-5-15(6-8-16)20(29)26-27-9-10-31-17(21(27)30)11-18(28)25-12-13-1-3-14(4-2-13)19(23)24/h1-8,17H,9-12,22H2,(H3,23,24)(H,25,28)(H,26,29)/t17-/m1/s1 |
| InChIKey | YFJNPGWGDSJKFD-QGZVFWFLSA-N |
| XLogP | 0.13 |
| TPSA | 163.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|