C21H23N5O5S — CID 70224120
N-(4-carbamimidoylphenyl)-2-[(2R)-4-(2,2-dioxo-3,4-dihydro-1H-2λ6,3-benzothiazin-6-yl)-3-oxomorpholin-2-yl]acetamide (PubChem CID 70224120) has the molecular formula C21H23N5O5S and a molecular weight of 457.51 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-2-[(2R)-4-(2,2-dioxo-3,4-dihydro-1H-2λ6,3-benzothiazin-6-yl)-3-oxomorpholin-2-yl]acetamide.
| Compound Name | N-(4-carbamimidoylphenyl)-2-[(2R)-4-(2,2-dioxo-3,4-dihydro-1H-2λ6,3-benzothiazin-6-yl)-3-oxomorpholin-2-yl]acetamide |
|---|---|
| PubChem CID | 70224120 |
| Molecular Formula | C21H23N5O5S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-2-[(2R)-4-(2,2-dioxo-3,4-dihydro-1H-2λ6,3-benzothiazin-6-yl)-3-oxomorpholin-2-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C[C@H]2OCCN(c3ccc4c(c3)CNS(=O)(=O)C4)C2=O)cc1 |
| InChI | InChI=1S/C21H23N5O5S/c22-20(23)13-1-4-16(5-2-13)25-19(27)10-18-21(28)26(7-8-31-18)17-6-3-14-12-32(29,30)24-11-15(14)9-17/h1-6,9,18,24H,7-8,10-12H2,(H3,22,23)(H,25,27)/t18-/m1/s1 |
| InChIKey | KWGBJTOQKRXMBV-GOSISDBHSA-N |
| XLogP | 0.66 |
| TPSA | 154.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|