C20H23ClN4O5 — CID 67222073
(2R)-N-(4-carbamimidoylphenyl)-2-hydroxy-2-[(2R)-4-[4-(hydroxymethyl)phenyl]-3-oxomorpholin-2-yl]acetamide;hydrochloride (PubChem CID 67222073) has the molecular formula C20H23ClN4O5 and a molecular weight of 434.88 g/mol. Its IUPAC name is (2R)-N-(4-carbamimidoylphenyl)-2-hydroxy-2-[(2R)-4-[4-(hydroxymethyl)phenyl]-3-oxomorpholin-2-yl]acetamide;hydrochloride.
| Compound Name | (2R)-N-(4-carbamimidoylphenyl)-2-hydroxy-2-[(2R)-4-[4-(hydroxymethyl)phenyl]-3-oxomorpholin-2-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 67222073 |
| Molecular Formula | C20H23ClN4O5 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (2R)-N-(4-carbamimidoylphenyl)-2-hydroxy-2-[(2R)-4-[4-(hydroxymethyl)phenyl]-3-oxomorpholin-2-yl]acetamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(=O)[C@H](O)[C@H]2OCCN(c3ccc(CO)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H22N4O5.ClH/c21-18(22)13-3-5-14(6-4-13)23-19(27)16(26)17-20(28)24(9-10-29-17)15-7-1-12(11-25)2-8-15;/h1-8,16-17,25-26H,9-11H2,(H3,21,22)(H,23,27);1H/t16-,17-;/m1./s1 |
| InChIKey | LOJSVXUMOIEDHX-GBNZRNLASA-N |
| XLogP | 0.62 |
| TPSA | 148.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|